C9H10Cl2O — CID 71215672
1,5-dichloro-3-ethyl-2-methoxybenzene (PubChem CID 71215672) has the molecular formula C9H10Cl2O and a molecular weight of 205.08 g/mol. Its IUPAC name is 1,5-dichloro-3-ethyl-2-methoxybenzene.
| Compound Name | 1,5-dichloro-3-ethyl-2-methoxybenzene |
|---|---|
| PubChem CID | 71215672 |
| Molecular Formula | C9H10Cl2O |
| Molecular Weight | 205.08 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 1,5-dichloro-3-ethyl-2-methoxybenzene |
| SMILES | CCc1cc(Cl)cc(Cl)c1OC |
| InChI | InChI=1S/C9H10Cl2O/c1-3-6-4-7(10)5-8(11)9(6)12-2/h4-5H,3H2,1-2H3 |
| InChIKey | HPQLOOZQLPFQMN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.08 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |