C9H9Cl3O — CID 82477195
1,5-dichloro-3-(2-chloroethyl)-2-methoxybenzene (PubChem CID 82477195) has the molecular formula C9H9Cl3O and a molecular weight of 239.53 g/mol. Its IUPAC name is 1,5-dichloro-3-(2-chloroethyl)-2-methoxybenzene.
| Compound Name | 1,5-dichloro-3-(2-chloroethyl)-2-methoxybenzene |
|---|---|
| PubChem CID | 82477195 |
| Molecular Formula | C9H9Cl3O |
| Molecular Weight | 239.53 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | 1,5-dichloro-3-(2-chloroethyl)-2-methoxybenzene |
| SMILES | COc1c(Cl)cc(Cl)cc1CCCl |
| InChI | InChI=1S/C9H9Cl3O/c1-13-9-6(2-3-10)4-7(11)5-8(9)12/h4-5H,2-3H2,1H3 |
| InChIKey | HIFUWUUPIYCOHS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|