C12H19Cl3N2O2 — CID 11957133
2-[2-[(3,5-dichloro-2-methoxyphenyl)methylamino]ethylamino]ethanol;hydrochloride (PubChem CID 11957133) has the molecular formula C12H19Cl3N2O2 and a molecular weight of 329.66 g/mol. Its IUPAC name is 2-[2-[(3,5-dichloro-2-methoxyphenyl)methylamino]ethylamino]ethanol;hydrochloride.
| Compound Name | 2-[2-[(3,5-dichloro-2-methoxyphenyl)methylamino]ethylamino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 11957133 |
| Molecular Formula | C12H19Cl3N2O2 |
| Molecular Weight | 329.66 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-[2-[(3,5-dichloro-2-methoxyphenyl)methylamino]ethylamino]ethanol;hydrochloride |
| SMILES | COc1c(Cl)cc(Cl)cc1CNCCNCCO.Cl |
| InChI | InChI=1S/C12H18Cl2N2O2.ClH/c1-18-12-9(6-10(13)7-11(12)14)8-16-3-2-15-4-5-17;/h6-7,15-17H,2-5,8H2,1H3;1H |
| InChIKey | VYROEHVLQOPGOX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.66 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|