C16H17Cl4N3O3 — CID 17294090
N'-(2-chloro-4-nitrophenyl)-N-[(3,5-dichloro-2-methoxyphenyl)methyl]ethane-1,2-diamine;hydrochloride (PubChem CID 17294090) has the molecular formula C16H17Cl4N3O3 and a molecular weight of 441.14 g/mol. Its IUPAC name is N'-(2-chloro-4-nitrophenyl)-N-[(3,5-dichloro-2-methoxyphenyl)methyl]ethane-1,2-diamine;hydrochloride.
| Compound Name | N'-(2-chloro-4-nitrophenyl)-N-[(3,5-dichloro-2-methoxyphenyl)methyl]ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 17294090 |
| Molecular Formula | C16H17Cl4N3O3 |
| Molecular Weight | 441.14 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | N'-(2-chloro-4-nitrophenyl)-N-[(3,5-dichloro-2-methoxyphenyl)methyl]ethane-1,2-diamine;hydrochloride |
| SMILES | COc1c(Cl)cc(Cl)cc1CNCCNc1ccc([N+](=O)[O-])cc1Cl.Cl |
| InChI | InChI=1S/C16H16Cl3N3O3.ClH/c1-25-16-10(6-11(17)7-14(16)19)9-20-4-5-21-15-3-2-12(22(23)24)8-13(15)18;/h2-3,6-8,20-21H,4-5,9H2,1H3;1H |
| InChIKey | BBBIOXZFDAZXNF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.14 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|