C18H21Cl3N4O5 — CID 17292442
2-[2-chloro-4-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]-6-methoxyphenoxy]acetamide;hydrochloride (PubChem CID 17292442) has the molecular formula C18H21Cl3N4O5 and a molecular weight of 479.75 g/mol. Its IUPAC name is 2-[2-chloro-4-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]-6-methoxyphenoxy]acetamide;hydrochloride.
| Compound Name | 2-[2-chloro-4-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]-6-methoxyphenoxy]acetamide;hydrochloride |
|---|---|
| PubChem CID | 17292442 |
| Molecular Formula | C18H21Cl3N4O5 |
| Molecular Weight | 479.75 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | 2-[2-chloro-4-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]-6-methoxyphenoxy]acetamide;hydrochloride |
| SMILES | COc1cc(CNCCNc2ccc([N+](=O)[O-])cc2Cl)cc(Cl)c1OCC(N)=O.Cl |
| InChI | InChI=1S/C18H20Cl2N4O5.ClH/c1-28-16-7-11(6-14(20)18(16)29-10-17(21)25)9-22-4-5-23-15-3-2-12(24(26)27)8-13(15)19;/h2-3,6-8,22-23H,4-5,9-10H2,1H3,(H2,21,25);1H |
| InChIKey | SWNRPOOFHOYQCW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.75 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|