C19H25Cl2N3O4 — CID 17292473
N'-(2-chloro-4-nitrophenyl)-N-[(3,4-diethoxyphenyl)methyl]ethane-1,2-diamine;hydrochloride (PubChem CID 17292473) has the molecular formula C19H25Cl2N3O4 and a molecular weight of 430.33 g/mol. Its IUPAC name is N'-(2-chloro-4-nitrophenyl)-N-[(3,4-diethoxyphenyl)methyl]ethane-1,2-diamine;hydrochloride.
| Compound Name | N'-(2-chloro-4-nitrophenyl)-N-[(3,4-diethoxyphenyl)methyl]ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 17292473 |
| Molecular Formula | C19H25Cl2N3O4 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N'-(2-chloro-4-nitrophenyl)-N-[(3,4-diethoxyphenyl)methyl]ethane-1,2-diamine;hydrochloride |
| SMILES | CCOc1ccc(CNCCNc2ccc([N+](=O)[O-])cc2Cl)cc1OCC.Cl |
| InChI | InChI=1S/C19H24ClN3O4.ClH/c1-3-26-18-8-5-14(11-19(18)27-4-2)13-21-9-10-22-17-7-6-15(23(24)25)12-16(17)20;/h5-8,11-12,21-22H,3-4,9-10,13H2,1-2H3;1H |
| InChIKey | LJJXTLUBLVJCLM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|