C24H24Cl3N3O4 — CID 4717706
N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine (PubChem CID 4717706) has the molecular formula C24H24Cl3N3O4 and a molecular weight of 524.83 g/mol. Its IUPAC name is N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 4717706 |
| Molecular Formula | C24H24Cl3N3O4 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine |
| SMILES | CCOc1cc(CNCCNc2ccc([N+](=O)[O-])cc2Cl)cc(Cl)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H24Cl3N3O4/c1-2-33-23-12-16(11-21(27)24(23)34-15-17-5-3-4-6-19(17)25)14-28-9-10-29-22-8-7-18(30(31)32)13-20(22)26/h3-8,11-13,28-29H,2,9-10,14-15H2,1H3 |
| InChIKey | VDWFBBFSLXTDEY-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|