C24H25Cl2N3O4 — CID 4722314
N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine (PubChem CID 4722314) has the molecular formula C24H25Cl2N3O4 and a molecular weight of 490.39 g/mol. Its IUPAC name is N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 4722314 |
| Molecular Formula | C24H25Cl2N3O4 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | N-[[3-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine |
| SMILES | CCOc1cc(CNCCNc2ccc([N+](=O)[O-])cc2)cc(Cl)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H25Cl2N3O4/c1-2-32-23-14-17(13-22(26)24(23)33-16-18-5-3-4-6-21(18)25)15-27-11-12-28-19-7-9-20(10-8-19)29(30)31/h3-10,13-14,27-28H,2,11-12,15-16H2,1H3 |
| InChIKey | KOCFWLFHUSEWPM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|