C24H26Cl3N3O4 — CID 17292400
N'-(2-chloro-4-nitrophenyl)-N-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethane-1,2-diamine;hydrochloride (PubChem CID 17292400) has the molecular formula C24H26Cl3N3O4 and a molecular weight of 526.85 g/mol. Its IUPAC name is N'-(2-chloro-4-nitrophenyl)-N-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethane-1,2-diamine;hydrochloride.
| Compound Name | N'-(2-chloro-4-nitrophenyl)-N-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 17292400 |
| Molecular Formula | C24H26Cl3N3O4 |
| Molecular Weight | 526.85 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | N'-(2-chloro-4-nitrophenyl)-N-[[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]ethane-1,2-diamine;hydrochloride |
| SMILES | CCOc1cc(CNCCNc2ccc([N+](=O)[O-])cc2Cl)ccc1OCc1ccccc1Cl.Cl |
| InChI | InChI=1S/C24H25Cl2N3O4.ClH/c1-2-32-24-13-17(7-10-23(24)33-16-18-5-3-4-6-20(18)25)15-27-11-12-28-22-9-8-19(29(30)31)14-21(22)26;/h3-10,13-14,27-28H,2,11-12,15-16H2,1H3;1H |
| InChIKey | SSVDTEBZAQSJNZ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.85 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|