C22H20BrCl2N3O3 — CID 17057015
N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine (PubChem CID 17057015) has the molecular formula C22H20BrCl2N3O3 and a molecular weight of 525.23 g/mol. Its IUPAC name is N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 17057015 |
| Molecular Formula | C22H20BrCl2N3O3 |
| Molecular Weight | 525.23 g/mol |
| Exact Mass | 523.01 |
| IUPAC Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCCNCc2ccc(OCc3ccc(Cl)cc3)c(Br)c2)c(Cl)c1 |
| InChI | InChI=1S/C22H20BrCl2N3O3/c23-19-11-16(3-8-22(19)31-14-15-1-4-17(24)5-2-15)13-26-9-10-27-21-7-6-18(28(29)30)12-20(21)25/h1-8,11-12,26-27H,9-10,13-14H2 |
| InChIKey | FUEVUJAFSAZAEM-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.23 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|