C15H15BrClN3O2 — CID 4717635
N-[(4-bromophenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine (PubChem CID 4717635) has the molecular formula C15H15BrClN3O2 and a molecular weight of 384.66 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N-[(4-bromophenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 4717635 |
| Molecular Formula | C15H15BrClN3O2 |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCCNCc2ccc(Br)cc2)c(Cl)c1 |
| InChI | InChI=1S/C15H15BrClN3O2/c16-12-3-1-11(2-4-12)10-18-7-8-19-15-6-5-13(20(21)22)9-14(15)17/h1-6,9,18-19H,7-8,10H2 |
| InChIKey | XZRDMQQGFFGMKC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|