C19H17Br2Cl2N3O3 — CID 17213061
N'-(2-chloro-4-nitrophenyl)-N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]ethane-1,2-diamine;hydrochloride (PubChem CID 17213061) has the molecular formula C19H17Br2Cl2N3O3 and a molecular weight of 566.08 g/mol. Its IUPAC name is N'-(2-chloro-4-nitrophenyl)-N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]ethane-1,2-diamine;hydrochloride.
| Compound Name | N'-(2-chloro-4-nitrophenyl)-N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 17213061 |
| Molecular Formula | C19H17Br2Cl2N3O3 |
| Molecular Weight | 566.08 g/mol |
| Exact Mass | 562.90 |
| IUPAC Name | N'-(2-chloro-4-nitrophenyl)-N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]ethane-1,2-diamine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(NCCNCc2ccc(-c3ccc(Br)cc3Br)o2)c(Cl)c1 |
| InChI | InChI=1S/C19H16Br2ClN3O3.ClH/c20-12-1-4-15(16(21)9-12)19-6-3-14(28-19)11-23-7-8-24-18-5-2-13(25(26)27)10-17(18)22;/h1-6,9-10,23-24H,7-8,11H2;1H |
| InChIKey | NSOPSOWHCWZRMP-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.08 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|