C15H17BrN2O5 — CID 119111861
2-[2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylamino]ethoxy]ethanol (PubChem CID 119111861) has the molecular formula C15H17BrN2O5 and a molecular weight of 385.21 g/mol. Its IUPAC name is 2-[2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 119111861 |
| Molecular Formula | C15H17BrN2O5 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 2-[2-[[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylamino]ethoxy]ethanol |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(CNCCOCCO)o2)c(Br)c1 |
| InChI | InChI=1S/C15H17BrN2O5/c16-14-9-11(18(20)21)1-3-13(14)15-4-2-12(23-15)10-17-5-7-22-8-6-19/h1-4,9,17,19H,5-8,10H2 |
| InChIKey | WSBFHIIIQVRAMR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|