C16H18ClN3O4 — CID 119107890
N-[3-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylamino]propyl]acetamide (PubChem CID 119107890) has the molecular formula C16H18ClN3O4 and a molecular weight of 351.79 g/mol. Its IUPAC name is N-[3-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylamino]propyl]acetamide.
| Compound Name | N-[3-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylamino]propyl]acetamide |
|---|---|
| PubChem CID | 119107890 |
| Molecular Formula | C16H18ClN3O4 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[3-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylamino]propyl]acetamide |
| SMILES | CC(=O)NCCCNCc1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C16H18ClN3O4/c1-11(21)19-8-2-7-18-10-13-4-6-16(24-13)14-5-3-12(20(22)23)9-15(14)17/h3-6,9,18H,2,7-8,10H2,1H3,(H,19,21) |
| InChIKey | URROKKIFQIHCPA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|