C19H23ClN2O5 — CID 119107862
N-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methyl]-3-(oxolan-2-ylmethoxy)propan-1-amine (PubChem CID 119107862) has the molecular formula C19H23ClN2O5 and a molecular weight of 394.86 g/mol. Its IUPAC name is N-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methyl]-3-(oxolan-2-ylmethoxy)propan-1-amine.
| Compound Name | N-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methyl]-3-(oxolan-2-ylmethoxy)propan-1-amine |
|---|---|
| PubChem CID | 119107862 |
| Molecular Formula | C19H23ClN2O5 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methyl]-3-(oxolan-2-ylmethoxy)propan-1-amine |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(CNCCCOCC3CCCO3)o2)c(Cl)c1 |
| InChI | InChI=1S/C19H23ClN2O5/c20-18-11-14(22(23)24)4-6-17(18)19-7-5-15(27-19)12-21-8-2-9-25-13-16-3-1-10-26-16/h4-7,11,16,21H,1-3,8-10,12-13H2 |
| InChIKey | MCQJPABQRWNOOY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 86.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|