C17H19ClN2O5 — CID 122044068
2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylamino]-4-methylpentanoic acid (PubChem CID 122044068) has the molecular formula C17H19ClN2O5 and a molecular weight of 366.80 g/mol. Its IUPAC name is 2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylamino]-4-methylpentanoic acid.
| Compound Name | 2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122044068 |
| Molecular Formula | C17H19ClN2O5 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylamino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NCc1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1)C(=O)O |
| InChI | InChI=1S/C17H19ClN2O5/c1-10(2)7-15(17(21)22)19-9-12-4-6-16(25-12)13-5-3-11(20(23)24)8-14(13)18/h3-6,8,10,15,19H,7,9H2,1-2H3,(H,21,22) |
| InChIKey | XBABSQJCHHDGRL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|