C28H21ClN2O7 — CID 170882407
3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 170882407) has the molecular formula C28H21ClN2O7 and a molecular weight of 532.94 g/mol. Its IUPAC name is 3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 170882407 |
| Molecular Formula | C28H21ClN2O7 |
| Molecular Weight | 532.94 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | 3-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(NC(Cc1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H21ClN2O7/c29-24-13-16(31(35)36)9-11-22(24)26-12-10-17(38-26)14-25(27(32)33)30-28(34)37-15-23-20-7-3-1-5-18(20)19-6-2-4-8-21(19)23/h1-13,23,25H,14-15H2,(H,30,34)(H,32,33) |
| InChIKey | NXNUIRMVVOBILA-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.94 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|