C28H26N4O7 — CID 170882576
3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 170882576) has the molecular formula C28H26N4O7 and a molecular weight of 530.54 g/mol. Its IUPAC name is 3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 170882576 |
| Molecular Formula | C28H26N4O7 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | 3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | Cc1nn(Cc2ccc(CC(NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)O)o2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C28H26N4O7/c1-16-26(32(36)37)17(2)31(30-16)14-19-12-11-18(39-19)13-25(27(33)34)29-28(35)38-15-24-22-9-5-3-7-20(22)21-8-4-6-10-23(21)24/h3-12,24-25H,13-15H2,1-2H3,(H,29,35)(H,33,34) |
| InChIKey | VIJIVLXVNVDVBW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 149.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|