C13H16N4O5 — CID 170879803
2-amino-3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]propanoic acid (PubChem CID 170879803) has the molecular formula C13H16N4O5 and a molecular weight of 308.29 g/mol. Its IUPAC name is 2-amino-3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]propanoic acid.
| Compound Name | 2-amino-3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 170879803 |
| Molecular Formula | C13H16N4O5 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-amino-3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]propanoic acid |
| SMILES | Cc1nn(Cc2ccc(CC(N)C(=O)O)o2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N4O5/c1-7-12(17(20)21)8(2)16(15-7)6-10-4-3-9(22-10)5-11(14)13(18)19/h3-4,11H,5-6,14H2,1-2H3,(H,18,19) |
| InChIKey | HDTOXPKBMWCWBF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 137.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|