C19H16FN3O4 — CID 19551189
(E)-3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 19551189) has the molecular formula C19H16FN3O4 and a molecular weight of 369.35 g/mol. Its IUPAC name is (E)-3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19551189 |
| Molecular Formula | C19H16FN3O4 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (E)-3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]-1-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | Cc1nn(Cc2ccc(/C=C/C(=O)c3ccc(F)cc3)o2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16FN3O4/c1-12-19(23(25)26)13(2)22(21-12)11-17-8-7-16(27-17)9-10-18(24)14-3-5-15(20)6-4-14/h3-10H,11H2,1-2H3/b10-9+ |
| InChIKey | OYCBQPGCAKTINL-MDZDMXLPSA-N |
| XLogP | 4.08 |
| TPSA | 91.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|