C15H20N4O5 — CID 170885457
ethyl 2-amino-3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]propanoate (PubChem CID 170885457) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is ethyl 2-amino-3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]propanoate.
| Compound Name | ethyl 2-amino-3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]propanoate |
|---|---|
| PubChem CID | 170885457 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | ethyl 2-amino-3-[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(Cn2nc(C)c([N+](=O)[O-])c2C)o1 |
| InChI | InChI=1S/C15H20N4O5/c1-4-23-15(20)13(16)7-11-5-6-12(24-11)8-18-10(3)14(19(21)22)9(2)17-18/h5-6,13H,4,7-8,16H2,1-3H3 |
| InChIKey | YJQLVHANDVSLEA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 126.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|