C9H9BrN4O3 — CID 55038267
1-[(5-bromofuran-2-yl)methyl]-3-methyl-4-nitropyrazol-5-amine (PubChem CID 55038267) has the molecular formula C9H9BrN4O3 and a molecular weight of 301.10 g/mol. Its IUPAC name is 1-[(5-bromofuran-2-yl)methyl]-3-methyl-4-nitropyrazol-5-amine.
| Compound Name | 1-[(5-bromofuran-2-yl)methyl]-3-methyl-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 55038267 |
| Molecular Formula | C9H9BrN4O3 |
| Molecular Weight | 301.10 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 1-[(5-bromofuran-2-yl)methyl]-3-methyl-4-nitropyrazol-5-amine |
| SMILES | Cc1nn(Cc2ccc(Br)o2)c(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9BrN4O3/c1-5-8(14(15)16)9(11)13(12-5)4-6-2-3-7(10)17-6/h2-3H,4,11H2,1H3 |
| InChIKey | HGARKFDPEQPLQM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 100.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.10 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|