C8H12N4O4 — CID 64581687
2-amino-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid (PubChem CID 64581687) has the molecular formula C8H12N4O4 and a molecular weight of 228.21 g/mol. Its IUPAC name is 2-amino-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid.
| Compound Name | 2-amino-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 64581687 |
| Molecular Formula | C8H12N4O4 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-amino-3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid |
| SMILES | Cc1nn(CC(N)C(=O)O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H12N4O4/c1-4-7(12(15)16)5(2)11(10-4)3-6(9)8(13)14/h6H,3,9H2,1-2H3,(H,13,14) |
| InChIKey | WVAUGGJKPURIES-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|