C11H20N4O5 — CID 66168892
3-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-hydroxypropyl]amino]propane-1,2-diol (PubChem CID 66168892) has the molecular formula C11H20N4O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is 3-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-hydroxypropyl]amino]propane-1,2-diol.
| Compound Name | 3-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-hydroxypropyl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 66168892 |
| Molecular Formula | C11H20N4O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-hydroxypropyl]amino]propane-1,2-diol |
| SMILES | Cc1nn(CC(O)CNCC(O)CO)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H20N4O5/c1-7-11(15(19)20)8(2)14(13-7)5-9(17)3-12-4-10(18)6-16/h9-10,12,16-18H,3-6H2,1-2H3 |
| InChIKey | DKEKDZBLAJTZLE-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|