C8H14N4O2 — CID 102689139
1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-amine (PubChem CID 102689139) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-amine.
| Compound Name | 1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-amine |
|---|---|
| PubChem CID | 102689139 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-amine |
| SMILES | Cc1nn(CC(C)N)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H14N4O2/c1-5(9)4-11-7(3)8(12(13)14)6(2)10-11/h5H,4,9H2,1-3H3 |
| InChIKey | XJJNLZNYHNVEKC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|