C13H15N3O3 — CID 40808608
(1S)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-phenylethanol (PubChem CID 40808608) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is (1S)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-phenylethanol.
| Compound Name | (1S)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-phenylethanol |
|---|---|
| PubChem CID | 40808608 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (1S)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-phenylethanol |
| SMILES | Cc1nn(C[C@@H](O)c2ccccc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N3O3/c1-9-13(16(18)19)10(2)15(14-9)8-12(17)11-6-4-3-5-7-11/h3-7,12,17H,8H2,1-2H3/t12-/m1/s1 |
| InChIKey | ODMVVKWVGOHHNW-GFCCVEGCSA-N |
| XLogP | 2.14 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|