C18H17N3O2 — CID 9453009
3,5-dimethyl-4-nitro-1-[(4-phenylphenyl)methyl]pyrazole (PubChem CID 9453009) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3,5-dimethyl-4-nitro-1-[(4-phenylphenyl)methyl]pyrazole.
| Compound Name | 3,5-dimethyl-4-nitro-1-[(4-phenylphenyl)methyl]pyrazole |
|---|---|
| PubChem CID | 9453009 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 3,5-dimethyl-4-nitro-1-[(4-phenylphenyl)methyl]pyrazole |
| SMILES | Cc1nn(Cc2ccc(-c3ccccc3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17N3O2/c1-13-18(21(22)23)14(2)20(19-13)12-15-8-10-17(11-9-15)16-6-4-3-5-7-16/h3-11H,12H2,1-2H3 |
| InChIKey | HBJGHQHDWTYVCV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|