C11H11ClN4O2 — CID 55075456
2-chloro-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyridine (PubChem CID 55075456) has the molecular formula C11H11ClN4O2 and a molecular weight of 266.69 g/mol. Its IUPAC name is 2-chloro-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyridine.
| Compound Name | 2-chloro-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 55075456 |
| Molecular Formula | C11H11ClN4O2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-chloro-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyridine |
| SMILES | Cc1nn(Cc2cccnc2Cl)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11ClN4O2/c1-7-10(16(17)18)8(2)15(14-7)6-9-4-3-5-13-11(9)12/h3-5H,6H2,1-2H3 |
| InChIKey | QCKGZMWZSCJBPR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|