C16H15ClN4O2S — CID 8006241
2-chloro-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-7-methylsulfanylquinoline (PubChem CID 8006241) has the molecular formula C16H15ClN4O2S and a molecular weight of 362.84 g/mol. Its IUPAC name is 2-chloro-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-7-methylsulfanylquinoline.
| Compound Name | 2-chloro-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-7-methylsulfanylquinoline |
|---|---|
| PubChem CID | 8006241 |
| Molecular Formula | C16H15ClN4O2S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 2-chloro-3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-7-methylsulfanylquinoline |
| SMILES | CSc1ccc2cc(Cn3nc(C)c([N+](=O)[O-])c3C)c(Cl)nc2c1 |
| InChI | InChI=1S/C16H15ClN4O2S/c1-9-15(21(22)23)10(2)20(19-9)8-12-6-11-4-5-13(24-3)7-14(11)18-16(12)17/h4-7H,8H2,1-3H3 |
| InChIKey | JDXXZDOCHQDQFO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|