C13H12N3O4- — CID 7015130
2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate (PubChem CID 7015130) has the molecular formula C13H12N3O4- and a molecular weight of 274.26 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate.
| Compound Name | 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 7015130 |
| Molecular Formula | C13H12N3O4- |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate |
| SMILES | Cc1nn(Cc2ccccc2C(=O)[O-])c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13N3O4/c1-8-12(16(19)20)9(2)15(14-8)7-10-5-3-4-6-11(10)13(17)18/h3-6H,7H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | JXVWZWVFPOLJOL-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 101.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|