C15H15N5O2 — CID 31808029
2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-methylquinazoline (PubChem CID 31808029) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-methylquinazoline.
| Compound Name | 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-methylquinazoline |
|---|---|
| PubChem CID | 31808029 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-methylquinazoline |
| SMILES | Cc1nn(Cc2nc(C)c3ccccc3n2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N5O2/c1-9-12-6-4-5-7-13(12)17-14(16-9)8-19-11(3)15(20(21)22)10(2)18-19/h4-7H,8H2,1-3H3 |
| InChIKey | XQBSMCHFESSRTD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|