C18H15N9O2 — CID 17022275
4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 17022275) has the molecular formula C18H15N9O2 and a molecular weight of 389.38 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 17022275 |
| Molecular Formula | C18H15N9O2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1nn(Cc2nc3c4cnn(-c5ccccc5)c4ncn3n2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15N9O2/c1-11-16(27(28)29)12(2)24(22-11)9-15-21-18-14-8-20-26(13-6-4-3-5-7-13)17(14)19-10-25(18)23-15/h3-8,10H,9H2,1-2H3 |
| InChIKey | JHBFCKYOCJMEGK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 121.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|