C18H14F2N8O2S — CID 19589998
13-(difluoromethyl)-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-11-methyl-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene (PubChem CID 19589998) has the molecular formula C18H14F2N8O2S and a molecular weight of 444.43 g/mol. Its IUPAC name is 13-(difluoromethyl)-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-11-methyl-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene.
| Compound Name | 13-(difluoromethyl)-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-11-methyl-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene |
|---|---|
| PubChem CID | 19589998 |
| Molecular Formula | C18H14F2N8O2S |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 13-(difluoromethyl)-4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-11-methyl-16-thia-3,5,6,8,14-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10(15),11,13-heptaene |
| SMILES | Cc1nn(Cc2nc3c4sc5nc(C(F)F)cc(C)c5c4ncn3n2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14F2N8O2S/c1-7-4-10(16(19)20)22-18-12(7)13-15(31-18)17-23-11(25-27(17)6-21-13)5-26-9(3)14(28(29)30)8(2)24-26/h4,6,16H,5H2,1-3H3 |
| InChIKey | WQTUJCVJRMJOFL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 116.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|