C24H20N8 — CID 4777503
4-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 4777503) has the molecular formula C24H20N8 and a molecular weight of 420.48 g/mol. Its IUPAC name is 4-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 4777503 |
| Molecular Formula | C24H20N8 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 4-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1cc(C)n(Cc2cccc(-c3nc4c5cnn(-c6ccccc6)c5ncn4n3)c2)n1 |
| InChI | InChI=1S/C24H20N8/c1-16-11-17(2)30(28-16)14-18-7-6-8-19(12-18)22-27-24-21-13-26-32(20-9-4-3-5-10-20)23(21)25-15-31(24)29-22/h3-13,15H,14H2,1-2H3 |
| InChIKey | MCTZQRLFEPKXDR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 78.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |