C18H16N8 — CID 4776628
4-[(3,5-dimethylpyrazol-1-yl)methyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 4776628) has the molecular formula C18H16N8 and a molecular weight of 344.38 g/mol. Its IUPAC name is 4-[(3,5-dimethylpyrazol-1-yl)methyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 4776628 |
| Molecular Formula | C18H16N8 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1cc(C)n(Cc2nc3c4cnn(-c5ccccc5)c4ncn3n2)n1 |
| InChI | InChI=1S/C18H16N8/c1-12-8-13(2)24(22-12)10-16-21-18-15-9-20-26(14-6-4-3-5-7-14)17(15)19-11-25(18)23-16/h3-9,11H,10H2,1-2H3 |
| InChIKey | JUCBNPAKNSZBIY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |