C19H17BrN8 — CID 19582520
4-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19582520) has the molecular formula C19H17BrN8 and a molecular weight of 437.31 g/mol. Its IUPAC name is 4-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19582520 |
| Molecular Formula | C19H17BrN8 |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 4-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1nn(CCc2nc3c4cnn(-c5ccccc5)c4ncn3n2)c(C)c1Br |
| InChI | InChI=1S/C19H17BrN8/c1-12-17(20)13(2)26(24-12)9-8-16-23-19-15-10-22-28(14-6-4-3-5-7-14)18(15)21-11-27(19)25-16/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | FGPXSWZNOLFSKA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |