C20H15BrN6O — CID 23605281
10-(3-bromophenyl)-4-[(4-methoxyphenyl)methyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 23605281) has the molecular formula C20H15BrN6O and a molecular weight of 435.29 g/mol. Its IUPAC name is 10-(3-bromophenyl)-4-[(4-methoxyphenyl)methyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-(3-bromophenyl)-4-[(4-methoxyphenyl)methyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 23605281 |
| Molecular Formula | C20H15BrN6O |
| Molecular Weight | 435.29 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 10-(3-bromophenyl)-4-[(4-methoxyphenyl)methyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | COc1ccc(Cc2nc3c4cnn(-c5cccc(Br)c5)c4ncn3n2)cc1 |
| InChI | InChI=1S/C20H15BrN6O/c1-28-16-7-5-13(6-8-16)9-18-24-20-17-11-23-27(15-4-2-3-14(21)10-15)19(17)22-12-26(20)25-18/h2-8,10-12H,9H2,1H3 |
| InChIKey | JDPPKUDLPYXACC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |