C23H21N7O3 — CID 2005743
1-(3,4-dimethoxyphenyl)-N-[[10-(3-methylphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]methanimine (PubChem CID 2005743) has the molecular formula C23H21N7O3 and a molecular weight of 443.47 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-[[10-(3-methylphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]methanimine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-[[10-(3-methylphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]methanimine |
|---|---|
| PubChem CID | 2005743 |
| Molecular Formula | C23H21N7O3 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-[[10-(3-methylphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]methanimine |
| SMILES | COc1ccc(C=NOCc2nc3c4cnn(-c5cccc(C)c5)c4ncn3n2)cc1OC |
| InChI | InChI=1S/C23H21N7O3/c1-15-5-4-6-17(9-15)30-22-18(12-25-30)23-27-21(28-29(23)14-24-22)13-33-26-11-16-7-8-19(31-2)20(10-16)32-3/h4-12,14H,13H2,1-3H3 |
| InChIKey | TVJUTOXHIIRNDJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 100.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|