C25H24N6O3 — CID 41008861
(Z)-1-(3,4-dimethoxyphenyl)-N-[(11,12-dimethyl-10-phenyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]methanimine (PubChem CID 41008861) has the molecular formula C25H24N6O3 and a molecular weight of 456.51 g/mol. Its IUPAC name is (Z)-1-(3,4-dimethoxyphenyl)-N-[(11,12-dimethyl-10-phenyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]methanimine.
| Compound Name | (Z)-1-(3,4-dimethoxyphenyl)-N-[(11,12-dimethyl-10-phenyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]methanimine |
|---|---|
| PubChem CID | 41008861 |
| Molecular Formula | C25H24N6O3 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (Z)-1-(3,4-dimethoxyphenyl)-N-[(11,12-dimethyl-10-phenyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]methanimine |
| SMILES | COc1ccc(/C=N\OCc2nc3c4c(C)c(C)n(-c5ccccc5)c4ncn3n2)cc1OC |
| InChI | InChI=1S/C25H24N6O3/c1-16-17(2)31(19-8-6-5-7-9-19)24-23(16)25-28-22(29-30(25)15-26-24)14-34-27-13-18-10-11-20(32-3)21(12-18)33-4/h5-13,15H,14H2,1-4H3/b27-13- |
| InChIKey | DDDQGMVYOFWEQO-WKIKZPBSSA-N |
| XLogP | 4.25 |
| TPSA | 88.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|