C24H18ClN7OS — CID 41010201
(Z)-N-[[10-(1,3-benzothiazol-2-yl)-11,12-dimethyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]-1-(4-chlorophenyl)methanimine (PubChem CID 41010201) has the molecular formula C24H18ClN7OS and a molecular weight of 487.98 g/mol. Its IUPAC name is (Z)-N-[[10-(1,3-benzothiazol-2-yl)-11,12-dimethyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]-1-(4-chlorophenyl)methanimine.
| Compound Name | (Z)-N-[[10-(1,3-benzothiazol-2-yl)-11,12-dimethyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]-1-(4-chlorophenyl)methanimine |
|---|---|
| PubChem CID | 41010201 |
| Molecular Formula | C24H18ClN7OS |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | (Z)-N-[[10-(1,3-benzothiazol-2-yl)-11,12-dimethyl-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]methoxy]-1-(4-chlorophenyl)methanimine |
| SMILES | Cc1c(C)n(-c2nc3ccccc3s2)c2ncn3nc(CO/N=C\c4ccc(Cl)cc4)nc3c12 |
| InChI | InChI=1S/C24H18ClN7OS/c1-14-15(2)32(24-28-18-5-3-4-6-19(18)34-24)22-21(14)23-29-20(30-31(23)13-26-22)12-33-27-11-16-7-9-17(25)10-8-16/h3-11,13H,12H2,1-2H3/b27-11- |
| InChIKey | WKAHHMUEQJLOLF-BCHBDCPOSA-N |
| XLogP | 5.50 |
| TPSA | 82.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|