C22H17ClN6S2 — CID 2815922
6-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 2815922) has the molecular formula C22H17ClN6S2 and a molecular weight of 465.01 g/mol. Its IUPAC name is 6-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 2815922 |
| Molecular Formula | C22H17ClN6S2 |
| Molecular Weight | 465.01 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 6-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | C=CCn1c(Sc2ncnc3c2sc2nc(C)cc(C)c23)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H17ClN6S2/c1-4-9-29-19(14-5-7-15(23)8-6-14)27-28-22(29)31-21-18-17(24-11-25-21)16-12(2)10-13(3)26-20(16)30-18/h4-8,10-11H,1,9H2,2-3H3 |
| InChIKey | DUKVMXUPGPCBKN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.01 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|