C18H18FN5S — CID 133432916
4-ethyl-5-fluoro-6-[[5-(3-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]pyrimidine (PubChem CID 133432916) has the molecular formula C18H18FN5S and a molecular weight of 355.44 g/mol. Its IUPAC name is 4-ethyl-5-fluoro-6-[[5-(3-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]pyrimidine.
| Compound Name | 4-ethyl-5-fluoro-6-[[5-(3-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]pyrimidine |
|---|---|
| PubChem CID | 133432916 |
| Molecular Formula | C18H18FN5S |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 4-ethyl-5-fluoro-6-[[5-(3-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]pyrimidine |
| SMILES | C=CCn1c(Sc2ncnc(CC)c2F)nnc1-c1cccc(C)c1 |
| InChI | InChI=1S/C18H18FN5S/c1-4-9-24-16(13-8-6-7-12(3)10-13)22-23-18(24)25-17-15(19)14(5-2)20-11-21-17/h4,6-8,10-11H,1,5,9H2,2-3H3 |
| InChIKey | PREKFEPOWCPODQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|