C17H17FN4OS2 — CID 133416269
2-(6-ethyl-5-fluoropyrimidin-4-yl)sulfanyl-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 133416269) has the molecular formula C17H17FN4OS2 and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-(6-ethyl-5-fluoropyrimidin-4-yl)sulfanyl-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(6-ethyl-5-fluoropyrimidin-4-yl)sulfanyl-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 133416269 |
| Molecular Formula | C17H17FN4OS2 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-(6-ethyl-5-fluoropyrimidin-4-yl)sulfanyl-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(Sc2ncnc(CC)c2F)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C17H17FN4OS2/c1-5-7-22-16(23)12-9(3)10(4)24-14(12)21-17(22)25-15-13(18)11(6-2)19-8-20-15/h5,8H,1,6-7H2,2-4H3 |
| InChIKey | GWAZYPAAEWNEMQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|