C15H20N2O2S2 — CID 110931350
2-(4-hydroxybutylsulfanyl)-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 110931350) has the molecular formula C15H20N2O2S2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 2-(4-hydroxybutylsulfanyl)-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-hydroxybutylsulfanyl)-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 110931350 |
| Molecular Formula | C15H20N2O2S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-(4-hydroxybutylsulfanyl)-5,6-dimethyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCCCCO)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C15H20N2O2S2/c1-4-7-17-14(19)12-10(2)11(3)21-13(12)16-15(17)20-9-6-5-8-18/h4,18H,1,5-9H2,2-3H3 |
| InChIKey | BAVJXCDINFGXCO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|