C18H22N4OS2 — CID 87037558
5,6-dimethyl-2-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 87037558) has the molecular formula C18H22N4OS2 and a molecular weight of 374.54 g/mol. Its IUPAC name is 5,6-dimethyl-2-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5,6-dimethyl-2-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 87037558 |
| Molecular Formula | C18H22N4OS2 |
| Molecular Weight | 374.54 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 5,6-dimethyl-2-[3-(1-methylpyrazol-4-yl)propylsulfanyl]-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCCCc2cnn(C)c2)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C18H22N4OS2/c1-5-8-22-17(23)15-12(2)13(3)25-16(15)20-18(22)24-9-6-7-14-10-19-21(4)11-14/h5,10-11H,1,6-9H2,2-4H3 |
| InChIKey | LUOBPWJNSQSPPF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|