C16H20N2O3S2 — CID 16637338
ethyl 3-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanoate (PubChem CID 16637338) has the molecular formula C16H20N2O3S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is ethyl 3-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanoate.
| Compound Name | ethyl 3-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 16637338 |
| Molecular Formula | C16H20N2O3S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | ethyl 3-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanoate |
| SMILES | C=CCn1c(SCCC(=O)OCC)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C16H20N2O3S2/c1-5-8-18-15(20)13-10(3)11(4)23-14(13)17-16(18)22-9-7-12(19)21-6-2/h5H,1,6-9H2,2-4H3 |
| InChIKey | WKYCAZUFMGFDNG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|