C15H18N2O3S2 — CID 7885972
methyl (2S)-2-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanoate (PubChem CID 7885972) has the molecular formula C15H18N2O3S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is methyl (2S)-2-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanoate.
| Compound Name | methyl (2S)-2-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 7885972 |
| Molecular Formula | C15H18N2O3S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | methyl (2S)-2-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanoate |
| SMILES | C=CCn1c(S[C@@H](C)C(=O)OC)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C15H18N2O3S2/c1-6-7-17-13(18)11-8(2)9(3)21-12(11)16-15(17)22-10(4)14(19)20-5/h6,10H,1,7H2,2-5H3/t10-/m0/s1 |
| InChIKey | OWIFWUJOWCQREP-JTQLQIEISA-N |
| XLogP | 2.91 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|