C23H20N4O2S3 — CID 135925540
(Z)-2-(1,3-benzothiazol-2-yl)-4-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-3-hydroxypent-2-enenitrile (PubChem CID 135925540) has the molecular formula C23H20N4O2S3 and a molecular weight of 480.64 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-4-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-3-hydroxypent-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-4-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-3-hydroxypent-2-enenitrile |
|---|---|
| PubChem CID | 135925540 |
| Molecular Formula | C23H20N4O2S3 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-4-(5,6-dimethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-3-hydroxypent-2-enenitrile |
| SMILES | C=CCn1c(SC(C)/C(O)=C(\C#N)c2nc3ccccc3s2)nc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C23H20N4O2S3/c1-5-10-27-22(29)18-12(2)13(3)30-21(18)26-23(27)31-14(4)19(28)15(11-24)20-25-16-8-6-7-9-17(16)32-20/h5-9,14,28H,1,10H2,2-4H3/b19-15- |
| InChIKey | FUHIATFUVSGDOG-CYVLTUHYSA-N |
| XLogP | 5.84 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|