C21H19N5O3S3 — CID 135993432
2-[(Z)-4-(1,3-benzothiazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanyl-1-ethylbenzimidazole-5-sulfonamide (PubChem CID 135993432) has the molecular formula C21H19N5O3S3 and a molecular weight of 485.62 g/mol. Its IUPAC name is 2-[(Z)-4-(1,3-benzothiazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanyl-1-ethylbenzimidazole-5-sulfonamide.
| Compound Name | 2-[(Z)-4-(1,3-benzothiazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanyl-1-ethylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 135993432 |
| Molecular Formula | C21H19N5O3S3 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 2-[(Z)-4-(1,3-benzothiazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl]sulfanyl-1-ethylbenzimidazole-5-sulfonamide |
| SMILES | CCn1c(SC(C)/C(O)=C(\C#N)c2nc3ccccc3s2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C21H19N5O3S3/c1-3-26-17-9-8-13(32(23,28)29)10-16(17)25-21(26)30-12(2)19(27)14(11-22)20-24-15-6-4-5-7-18(15)31-20/h4-10,12,27H,3H2,1-2H3,(H2,23,28,29)/b19-14- |
| InChIKey | IGUAZBPFOGCDAH-RGEXLXHISA-N |
| XLogP | 4.29 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|