C17H18N6OS2 — CID 135902945
(4R)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpent-2-enenitrile (PubChem CID 135902945) has the molecular formula C17H18N6OS2 and a molecular weight of 386.51 g/mol. Its IUPAC name is (4R)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpent-2-enenitrile.
| Compound Name | (4R)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpent-2-enenitrile |
|---|---|
| PubChem CID | 135902945 |
| Molecular Formula | C17H18N6OS2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (4R)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpent-2-enenitrile |
| SMILES | CC(C)Cn1nnnc1S[C@H](C)C(O)=C(C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H18N6OS2/c1-10(2)9-23-17(20-21-22-23)25-11(3)15(24)12(8-18)16-19-13-6-4-5-7-14(13)26-16/h4-7,10-11,24H,9H2,1-3H3/t11-/m1/s1 |
| InChIKey | DAQYFOHFLVFISX-LLVKDONJSA-N |
| XLogP | 3.91 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|